About benzyl 2-[3-[(3,4-dichlorophenyl)methylidene]-2-oxoindol-1-yl]acetate
benzyl 2-[3-[(3,4-dichlorophenyl)methylidene]-2-oxoindol-1-yl]acetate (PubChem CID 54308760) has the molecular formula C24H17Cl2NO3
and a molecular weight of 438.31 g/mol. Its IUPAC name is benzyl 2-[3-[(3,4-dichlorophenyl)methylidene]-2-oxoindol-1-yl]acetate.
Molecular Properties
| Compound Name | benzyl 2-[3-[(3,4-dichlorophenyl)methylidene]-2-oxoindol-1-yl]acetate |
| PubChem CID | 54308760 |
| Molecular Formula | C24H17Cl2NO3 |
| Molecular Weight | 438.31 g/mol |
| Exact Mass | 437.06 |
| IUPAC Name | benzyl 2-[3-[(3,4-dichlorophenyl)methylidene]-2-oxoindol-1-yl]acetate |
| SMILES | O=C(CN1C(=O)C(=Cc2ccc(Cl)c(Cl)c2)c2ccccc21)OCc1ccccc1 |
| InChI | InChI=1S/C24H17Cl2NO3/c25-20-11-10-17(13-21(20)26)12-19-18-8-4-5-9-22(18)27(24(19)29)14-23(28)30-15-16-6-2-1-3-7-16/h1-13H,14-15H2 |
| InChIKey | SJJWLXNFKDINHP-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 438.31 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze benzyl 2-[3-[(3,4-dichlorophenyl)methylidene]-2-oxoindol-1-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 2-[3-[(3,4-dichlorophenyl)methylidene]-2-oxoindol-1-yl]acetate?
The IUPAC name of benzyl 2-[3-[(3,4-dichlorophenyl)methylidene]-2-oxoindol-1-yl]acetate (CID 54308760) is benzyl 2-[3-[(3,4-dichlorophenyl)methylidene]-2-oxoindol-1-yl]acetate.
What is the SMILES notation for benzyl 2-[3-[(3,4-dichlorophenyl)methylidene]-2-oxoindol-1-yl]acetate?
The canonical SMILES for benzyl 2-[3-[(3,4-dichlorophenyl)methylidene]-2-oxoindol-1-yl]acetate is O=C(CN1C(=O)C(=Cc2ccc(Cl)c(Cl)c2)c2ccccc21)OCc1ccccc1.
What is the InChIKey of benzyl 2-[3-[(3,4-dichlorophenyl)methylidene]-2-oxoindol-1-yl]acetate?
The InChIKey is SJJWLXNFKDINHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H17Cl2NO3/c25-20-11-10-17(13-21(20)26)12-19-18-8-4-5-9-22(18)27(24(19)29)14-23(28)30-15-16-6-2-1-3-7-16/h1-13H,14-15H2.
What are the key properties of benzyl 2-[3-[(3,4-dichlorophenyl)methylidene]-2-oxoindol-1-yl]acetate?
benzyl 2-[3-[(3,4-dichlorophenyl)methylidene]-2-oxoindol-1-yl]acetate has a molecular weight of 438.31 g/mol, XLogP of 5.62, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 2-[3-[(3,4-dichlorophenyl)methylidene]-2-oxoindol-1-yl]acetate is sourced from PubChem (CID 54308760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).