C35H74O4Si3 — CID 54308871
(6R)-1,3,7-tris[[tert-butyl(dimethyl)silyl]oxy]-4,4,6,8-tetramethyltridec-12-en-5-one (PubChem CID 54308871) has the molecular formula C35H74O4Si3 and a molecular weight of 643.23 g/mol. Its IUPAC name is (6R)-1,3,7-tris[[tert-butyl(dimethyl)silyl]oxy]-4,4,6,8-tetramethyltridec-12-en-5-one.
| Compound Name | (6R)-1,3,7-tris[[tert-butyl(dimethyl)silyl]oxy]-4,4,6,8-tetramethyltridec-12-en-5-one |
|---|---|
| PubChem CID | 54308871 |
| Molecular Formula | C35H74O4Si3 |
| Molecular Weight | 643.23 g/mol |
| Exact Mass | 642.49 |
| IUPAC Name | (6R)-1,3,7-tris[[tert-butyl(dimethyl)silyl]oxy]-4,4,6,8-tetramethyltridec-12-en-5-one |
| SMILES | C=CCCCC(C)C(O[Si](C)(C)C(C)(C)C)[C@@H](C)C(=O)C(C)(C)C(CCO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C35H74O4Si3/c1-21-22-23-24-27(2)30(39-42(19,20)34(10,11)12)28(3)31(36)35(13,14)29(38-41(17,18)33(7,8)9)25-26-37-40(15,16)32(4,5)6/h21,27-30H,1,22-26H2,2-20H3/t27?,28-,29?,30?/m1/s1 |
| InChIKey | SJMBCSIIHYWOLP-BJAWCZCISA-N |
| XLogP | 11.40 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.23 |
| LogP ≤ 5 | 11.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|