About 1-chlorooct-2-en-4-one
1-chlorooct-2-en-4-one (PubChem CID 54309788) has the molecular formula C8H13ClO
and a molecular weight of 160.64 g/mol. Its IUPAC name is 1-chlorooct-2-en-4-one.
Molecular Properties
| Compound Name | 1-chlorooct-2-en-4-one |
| PubChem CID | 54309788 |
| Molecular Formula | C8H13ClO |
| Molecular Weight | 160.64 g/mol |
| Exact Mass | 160.07 |
| IUPAC Name | 1-chlorooct-2-en-4-one |
| SMILES | CCCCC(=O)C=CCCl |
| InChI | InChI=1S/C8H13ClO/c1-2-3-5-8(10)6-4-7-9/h4,6H,2-3,5,7H2,1H3 |
| InChIKey | SKBPZUSMZALWMD-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.64 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-chlorooct-2-en-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chlorooct-2-en-4-one?
The IUPAC name of 1-chlorooct-2-en-4-one (CID 54309788) is 1-chlorooct-2-en-4-one.
What is the SMILES notation for 1-chlorooct-2-en-4-one?
The canonical SMILES for 1-chlorooct-2-en-4-one is CCCCC(=O)C=CCCl.
What is the InChIKey of 1-chlorooct-2-en-4-one?
The InChIKey is SKBPZUSMZALWMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13ClO/c1-2-3-5-8(10)6-4-7-9/h4,6H,2-3,5,7H2,1H3.
What are the key properties of 1-chlorooct-2-en-4-one?
1-chlorooct-2-en-4-one has a molecular weight of 160.64 g/mol, XLogP of 2.54, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chlorooct-2-en-4-one is sourced from PubChem (CID 54309788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).