C22H26O2 — CID 54309941
ethyl 3-methyl-7-(4-tricyclo[6.2.1.02,7]undeca-2(7),3,5-trienyl)octa-2,4,6-trienoate (PubChem CID 54309941) has the molecular formula C22H26O2 and a molecular weight of 322.45 g/mol. Its IUPAC name is ethyl 3-methyl-7-(4-tricyclo[6.2.1.02,7]undeca-2(7),3,5-trienyl)octa-2,4,6-trienoate.
| Compound Name | ethyl 3-methyl-7-(4-tricyclo[6.2.1.02,7]undeca-2(7),3,5-trienyl)octa-2,4,6-trienoate |
|---|---|
| PubChem CID | 54309941 |
| Molecular Formula | C22H26O2 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | ethyl 3-methyl-7-(4-tricyclo[6.2.1.02,7]undeca-2(7),3,5-trienyl)octa-2,4,6-trienoate |
| SMILES | CCOC(=O)C=C(C)C=CC=C(C)c1ccc2c(c1)C1CCC2C1 |
| InChI | InChI=1S/C22H26O2/c1-4-24-22(23)12-15(2)6-5-7-16(3)17-10-11-20-18-8-9-19(13-18)21(20)14-17/h5-7,10-12,14,18-19H,4,8-9,13H2,1-3H3 |
| InChIKey | SKDYHURNASVDLI-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|