C9H6F6 — CID 543102
5-ethenyl-1,2,3,4,7,7-hexafluorobicyclo[2.2.1]hept-2-ene (PubChem CID 543102) has the molecular formula C9H6F6 and a molecular weight of 228.13 g/mol. Its IUPAC name is 5-ethenyl-1,2,3,4,7,7-hexafluorobicyclo[2.2.1]hept-2-ene.
| Compound Name | 5-ethenyl-1,2,3,4,7,7-hexafluorobicyclo[2.2.1]hept-2-ene |
|---|---|
| PubChem CID | 543102 |
| Molecular Formula | C9H6F6 |
| Molecular Weight | 228.13 g/mol |
| Exact Mass | 228.04 |
| IUPAC Name | 5-ethenyl-1,2,3,4,7,7-hexafluorobicyclo[2.2.1]hept-2-ene |
| SMILES | C=CC1CC2(F)C(F)=C(F)C1(F)C2(F)F |
| InChI | InChI=1S/C9H6F6/c1-2-4-3-7(12)5(10)6(11)8(4,13)9(7,14)15/h2,4H,1,3H2 |
| InChIKey | JIQFYEPIIGAPMW-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.13 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|