About (7-acetyloxy-2,7-dimethyl-1,8-dinitrooct-2-en-4-yl) acetate
(7-acetyloxy-2,7-dimethyl-1,8-dinitrooct-2-en-4-yl) acetate (PubChem CID 54310278) has the molecular formula C14H22N2O8
and a molecular weight of 346.34 g/mol. Its IUPAC name is (7-acetyloxy-2,7-dimethyl-1,8-dinitrooct-2-en-4-yl) acetate.
Molecular Properties
| Compound Name | (7-acetyloxy-2,7-dimethyl-1,8-dinitrooct-2-en-4-yl) acetate |
| PubChem CID | 54310278 |
| Molecular Formula | C14H22N2O8 |
| Molecular Weight | 346.34 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | (7-acetyloxy-2,7-dimethyl-1,8-dinitrooct-2-en-4-yl) acetate |
| SMILES | CC(=O)OC(C=C(C)C[N+](=O)[O-])CCC(C)(C[N+](=O)[O-])OC(C)=O |
| InChI | InChI=1S/C14H22N2O8/c1-10(8-15(19)20)7-13(23-11(2)17)5-6-14(4,9-16(21)22)24-12(3)18/h7,13H,5-6,8-9H2,1-4H3 |
| InChIKey | SKJRWWFHMHWDSR-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 138.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.34 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (7-acetyloxy-2,7-dimethyl-1,8-dinitrooct-2-en-4-yl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-acetyloxy-2,7-dimethyl-1,8-dinitrooct-2-en-4-yl) acetate?
The IUPAC name of (7-acetyloxy-2,7-dimethyl-1,8-dinitrooct-2-en-4-yl) acetate (CID 54310278) is (7-acetyloxy-2,7-dimethyl-1,8-dinitrooct-2-en-4-yl) acetate.
What is the SMILES notation for (7-acetyloxy-2,7-dimethyl-1,8-dinitrooct-2-en-4-yl) acetate?
The canonical SMILES for (7-acetyloxy-2,7-dimethyl-1,8-dinitrooct-2-en-4-yl) acetate is CC(=O)OC(C=C(C)C[N+](=O)[O-])CCC(C)(C[N+](=O)[O-])OC(C)=O.
What is the InChIKey of (7-acetyloxy-2,7-dimethyl-1,8-dinitrooct-2-en-4-yl) acetate?
The InChIKey is SKJRWWFHMHWDSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22N2O8/c1-10(8-15(19)20)7-13(23-11(2)17)5-6-14(4,9-16(21)22)24-12(3)18/h7,13H,5-6,8-9H2,1-4H3.
What are the key properties of (7-acetyloxy-2,7-dimethyl-1,8-dinitrooct-2-en-4-yl) acetate?
(7-acetyloxy-2,7-dimethyl-1,8-dinitrooct-2-en-4-yl) acetate has a molecular weight of 346.34 g/mol, XLogP of 1.52, 10 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (7-acetyloxy-2,7-dimethyl-1,8-dinitrooct-2-en-4-yl) acetate is sourced from PubChem (CID 54310278), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).