C12H15BrCl3O2PS — CID 54310290
(4-bromophenyl)-butoxy-sulfanylidene-(2,2,2-trichloroethoxy)-λ5-phosphane (PubChem CID 54310290) has the molecular formula C12H15BrCl3O2PS and a molecular weight of 440.55 g/mol. Its IUPAC name is (4-bromophenyl)-butoxy-sulfanylidene-(2,2,2-trichloroethoxy)-λ5-phosphane.
| Compound Name | (4-bromophenyl)-butoxy-sulfanylidene-(2,2,2-trichloroethoxy)-λ5-phosphane |
|---|---|
| PubChem CID | 54310290 |
| Molecular Formula | C12H15BrCl3O2PS |
| Molecular Weight | 440.55 g/mol |
| Exact Mass | 437.88 |
| IUPAC Name | (4-bromophenyl)-butoxy-sulfanylidene-(2,2,2-trichloroethoxy)-λ5-phosphane |
| SMILES | CCCCOP(=S)(OCC(Cl)(Cl)Cl)c1ccc(Br)cc1 |
| InChI | InChI=1S/C12H15BrCl3O2PS/c1-2-3-8-17-19(20,18-9-12(14,15)16)11-6-4-10(13)5-7-11/h4-7H,2-3,8-9H2,1H3 |
| InChIKey | SKJZSUMADFDPIX-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.55 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|