About 3H-azepine-5-carboxylic acid
3H-azepine-5-carboxylic acid (PubChem CID 54310737) has the molecular formula C7H7NO2
and a molecular weight of 137.14 g/mol. Its IUPAC name is 3H-azepine-5-carboxylic acid.
Molecular Properties
| Compound Name | 3H-azepine-5-carboxylic acid |
| PubChem CID | 54310737 |
| Molecular Formula | C7H7NO2 |
| Molecular Weight | 137.14 g/mol |
| Exact Mass | 137.05 |
| IUPAC Name | 3H-azepine-5-carboxylic acid |
| SMILES | O=C(O)C1=CCC=NC=C1 |
| InChI | InChI=1S/C7H7NO2/c9-7(10)6-2-1-4-8-5-3-6/h2-5H,1H2,(H,9,10) |
| InChIKey | SKRNYRFRYHCTSA-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.14 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3H-azepine-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3H-azepine-5-carboxylic acid?
The IUPAC name of 3H-azepine-5-carboxylic acid (CID 54310737) is 3H-azepine-5-carboxylic acid.
What is the SMILES notation for 3H-azepine-5-carboxylic acid?
The canonical SMILES for 3H-azepine-5-carboxylic acid is O=C(O)C1=CCC=NC=C1.
What is the InChIKey of 3H-azepine-5-carboxylic acid?
The InChIKey is SKRNYRFRYHCTSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO2/c9-7(10)6-2-1-4-8-5-3-6/h2-5H,1H2,(H,9,10).
What are the key properties of 3H-azepine-5-carboxylic acid?
3H-azepine-5-carboxylic acid has a molecular weight of 137.14 g/mol, XLogP of 0.99, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3H-azepine-5-carboxylic acid is sourced from PubChem (CID 54310737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).