C8H2Cl5NO — CID 54310950
2-chloro-2-hydroxy-2-(2,3,4,5-tetrachlorophenyl)acetonitrile (PubChem CID 54310950) has the molecular formula C8H2Cl5NO and a molecular weight of 305.38 g/mol. Its IUPAC name is 2-chloro-2-hydroxy-2-(2,3,4,5-tetrachlorophenyl)acetonitrile.
| Compound Name | 2-chloro-2-hydroxy-2-(2,3,4,5-tetrachlorophenyl)acetonitrile |
|---|---|
| PubChem CID | 54310950 |
| Molecular Formula | C8H2Cl5NO |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 302.86 |
| IUPAC Name | 2-chloro-2-hydroxy-2-(2,3,4,5-tetrachlorophenyl)acetonitrile |
| SMILES | N#CC(O)(Cl)c1cc(Cl)c(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C8H2Cl5NO/c9-4-1-3(8(13,15)2-14)5(10)7(12)6(4)11/h1,15H |
| InChIKey | SKVHYCHGHOYVNH-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'cyanohydrins', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|