C17H15Cl3N2O4 — CID 54311394
3-[4-(N-carbamoyl-3,4,5-trichloroanilino)phenoxy]-2-methylpropanoic acid (PubChem CID 54311394) has the molecular formula C17H15Cl3N2O4 and a molecular weight of 417.68 g/mol. Its IUPAC name is 3-[4-(N-carbamoyl-3,4,5-trichloroanilino)phenoxy]-2-methylpropanoic acid.
| Compound Name | 3-[4-(N-carbamoyl-3,4,5-trichloroanilino)phenoxy]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 54311394 |
| Molecular Formula | C17H15Cl3N2O4 |
| Molecular Weight | 417.68 g/mol |
| Exact Mass | 416.01 |
| IUPAC Name | 3-[4-(N-carbamoyl-3,4,5-trichloroanilino)phenoxy]-2-methylpropanoic acid |
| SMILES | CC(COc1ccc(N(C(N)=O)c2cc(Cl)c(Cl)c(Cl)c2)cc1)C(=O)O |
| InChI | InChI=1S/C17H15Cl3N2O4/c1-9(16(23)24)8-26-12-4-2-10(3-5-12)22(17(21)25)11-6-13(18)15(20)14(19)7-11/h2-7,9H,8H2,1H3,(H2,21,25)(H,23,24) |
| InChIKey | SLDLBKSUPLWKHR-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 92.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.68 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|