C13H18O9 — CID 54311436
(4S,5S,6R)-4,5-diacetyl-4,5,6-trihydroxy-6-(hydroxymethyl)octane-2,3,7-trione (PubChem CID 54311436) has the molecular formula C13H18O9 and a molecular weight of 318.28 g/mol. Its IUPAC name is (4S,5S,6R)-4,5-diacetyl-4,5,6-trihydroxy-6-(hydroxymethyl)octane-2,3,7-trione.
| Compound Name | (4S,5S,6R)-4,5-diacetyl-4,5,6-trihydroxy-6-(hydroxymethyl)octane-2,3,7-trione |
|---|---|
| PubChem CID | 54311436 |
| Molecular Formula | C13H18O9 |
| Molecular Weight | 318.28 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | (4S,5S,6R)-4,5-diacetyl-4,5,6-trihydroxy-6-(hydroxymethyl)octane-2,3,7-trione |
| SMILES | CC(=O)C(=O)[C@@](O)(C(C)=O)[C@](O)(C(C)=O)[C@](O)(CO)C(C)=O |
| InChI | InChI=1S/C13H18O9/c1-6(15)10(19)12(21,8(3)17)13(22,9(4)18)11(20,5-14)7(2)16/h14,20-22H,5H2,1-4H3/t11-,12-,13-/m0/s1 |
| InChIKey | SLECBLCFEDTQGK-AVGNSLFASA-N |
| XLogP | -2.90 |
| TPSA | 166.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.28 |
| LogP ≤ 5 | -2.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|