C18H13ClN2O5 — CID 5431191
(5E)-3-(3-chlorophenyl)-5-[(6-methoxy-1,3-benzodioxol-5-yl)methylidene]imidazolidine-2,4-dione (PubChem CID 5431191) has the molecular formula C18H13ClN2O5 and a molecular weight of 372.76 g/mol. Its IUPAC name is (5E)-3-(3-chlorophenyl)-5-[(6-methoxy-1,3-benzodioxol-5-yl)methylidene]imidazolidine-2,4-dione.
| Compound Name | (5E)-3-(3-chlorophenyl)-5-[(6-methoxy-1,3-benzodioxol-5-yl)methylidene]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 5431191 |
| Molecular Formula | C18H13ClN2O5 |
| Molecular Weight | 372.76 g/mol |
| Exact Mass | 372.05 |
| IUPAC Name | (5E)-3-(3-chlorophenyl)-5-[(6-methoxy-1,3-benzodioxol-5-yl)methylidene]imidazolidine-2,4-dione |
| SMILES | COc1cc2c(cc1/C=C1/NC(=O)N(c3cccc(Cl)c3)C1=O)OCO2 |
| InChI | InChI=1S/C18H13ClN2O5/c1-24-14-8-16-15(25-9-26-16)6-10(14)5-13-17(22)21(18(23)20-13)12-4-2-3-11(19)7-12/h2-8H,9H2,1H3,(H,20,23)/b13-5+ |
| InChIKey | VDEKHFYXAKFVPD-WLRTZDKTSA-N |
| XLogP | 3.17 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.76 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|