C12H15Cl3N6O3 — CID 54312470
N-[4-amino-6-[bis(3-chloropropanoyl)amino]-1,3,5-triazin-2-yl]-3-chloropropanamide (PubChem CID 54312470) has the molecular formula C12H15Cl3N6O3 and a molecular weight of 397.65 g/mol. Its IUPAC name is N-[4-amino-6-[bis(3-chloropropanoyl)amino]-1,3,5-triazin-2-yl]-3-chloropropanamide.
| Compound Name | N-[4-amino-6-[bis(3-chloropropanoyl)amino]-1,3,5-triazin-2-yl]-3-chloropropanamide |
|---|---|
| PubChem CID | 54312470 |
| Molecular Formula | C12H15Cl3N6O3 |
| Molecular Weight | 397.65 g/mol |
| Exact Mass | 396.03 |
| IUPAC Name | N-[4-amino-6-[bis(3-chloropropanoyl)amino]-1,3,5-triazin-2-yl]-3-chloropropanamide |
| SMILES | Nc1nc(NC(=O)CCCl)nc(N(C(=O)CCCl)C(=O)CCCl)n1 |
| InChI | InChI=1S/C12H15Cl3N6O3/c13-4-1-7(22)17-11-18-10(16)19-12(20-11)21(8(23)2-5-14)9(24)3-6-15/h1-6H2,(H3,16,17,18,19,20,22) |
| InChIKey | SLWAZLVUHVTCRK-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 131.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.65 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|