C33H64O3Si2 — CID 54312536
5-[(3aS,5R,6S,6aS)-5-[tert-butyl(dimethyl)silyl]oxy-6-[(3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]pentan-1-ol (PubChem CID 54312536) has the molecular formula C33H64O3Si2 and a molecular weight of 565.04 g/mol. Its IUPAC name is 5-[(3aS,5R,6S,6aS)-5-[tert-butyl(dimethyl)silyl]oxy-6-[(3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]pentan-1-ol.
| Compound Name | 5-[(3aS,5R,6S,6aS)-5-[tert-butyl(dimethyl)silyl]oxy-6-[(3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]pentan-1-ol |
|---|---|
| PubChem CID | 54312536 |
| Molecular Formula | C33H64O3Si2 |
| Molecular Weight | 565.04 g/mol |
| Exact Mass | 564.44 |
| IUPAC Name | 5-[(3aS,5R,6S,6aS)-5-[tert-butyl(dimethyl)silyl]oxy-6-[(3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]pentan-1-ol |
| SMILES | CCCCC[C@@H](C=C[C@H]1[C@H]2CC(CCCCCO)=C[C@H]2C[C@H]1O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C33H64O3Si2/c1-12-13-15-19-28(35-37(8,9)32(2,3)4)20-21-29-30-24-26(18-16-14-17-22-34)23-27(30)25-31(29)36-38(10,11)33(5,6)7/h20-21,23,27-31,34H,12-19,22,24-25H2,1-11H3/t27-,28-,29-,30-,31+/m0/s1 |
| InChIKey | SLXKHNJCCZKCMS-STVCLKQXSA-N |
| XLogP | 10.04 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.04 |
| LogP ≤ 5 | 10.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|