About 3a,4,6,6a-tetrahydro-1H-cyclopenta[c]furan-3,5-dione
3a,4,6,6a-tetrahydro-1H-cyclopenta[c]furan-3,5-dione (PubChem CID 543141) has the molecular formula C7H8O3
and a molecular weight of 140.14 g/mol. Its IUPAC name is 3a,4,6,6a-tetrahydro-1H-cyclopenta[c]furan-3,5-dione.
Analyze 3a,4,6,6a-tetrahydro-1H-cyclopenta[c]furan-3,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3a,4,6,6a-tetrahydro-1H-cyclopenta[c]furan-3,5-dione?
The IUPAC name of 3a,4,6,6a-tetrahydro-1H-cyclopenta[c]furan-3,5-dione (CID 543141) is 3a,4,6,6a-tetrahydro-1H-cyclopenta[c]furan-3,5-dione.
What is the SMILES notation for 3a,4,6,6a-tetrahydro-1H-cyclopenta[c]furan-3,5-dione?
The canonical SMILES for 3a,4,6,6a-tetrahydro-1H-cyclopenta[c]furan-3,5-dione is O=C1CC2COC(=O)C2C1.
What is the InChIKey of 3a,4,6,6a-tetrahydro-1H-cyclopenta[c]furan-3,5-dione?
The InChIKey is CZBRZSXUKXNIET-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O3/c8-5-1-4-3-10-7(9)6(4)2-5/h4,6H,1-3H2.
What are the key properties of 3a,4,6,6a-tetrahydro-1H-cyclopenta[c]furan-3,5-dione?
3a,4,6,6a-tetrahydro-1H-cyclopenta[c]furan-3,5-dione has a molecular weight of 140.14 g/mol, XLogP of 0.14, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3a,4,6,6a-tetrahydro-1H-cyclopenta[c]furan-3,5-dione is sourced from PubChem (CID 543141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).