C23H35NO — CID 54314150
(8R,9S,10R,13S,14S)-3-(diethylamino)-10,13-dimethyl-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-one (PubChem CID 54314150) has the molecular formula C23H35NO and a molecular weight of 341.54 g/mol. Its IUPAC name is (8R,9S,10R,13S,14S)-3-(diethylamino)-10,13-dimethyl-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-one.
| Compound Name | (8R,9S,10R,13S,14S)-3-(diethylamino)-10,13-dimethyl-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 54314150 |
| Molecular Formula | C23H35NO |
| Molecular Weight | 341.54 g/mol |
| Exact Mass | 341.27 |
| IUPAC Name | (8R,9S,10R,13S,14S)-3-(diethylamino)-10,13-dimethyl-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-one |
| SMILES | CCN(CC)C1=CC2=CC[C@@H]3[C@H](CC[C@]4(C)C(=O)CC[C@@H]34)[C@@]2(C)CC1 |
| InChI | InChI=1S/C23H35NO/c1-5-24(6-2)17-11-13-22(3)16(15-17)7-8-18-19-9-10-21(25)23(19,4)14-12-20(18)22/h7,15,18-20H,5-6,8-14H2,1-4H3/t18-,19-,20-,22-,23-/m0/s1 |
| InChIKey | SMYYITFZNDEYRP-CWMMHYCISA-N |
| XLogP | 5.35 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.54 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |