C6H10O7S — CID 54314250
(2S,3S,4S,5R)-2,3,4,5-tetrahydroxy-6-oxo-6-sulfanylhexanoic acid (PubChem CID 54314250) has the molecular formula C6H10O7S and a molecular weight of 226.21 g/mol. Its IUPAC name is (2S,3S,4S,5R)-2,3,4,5-tetrahydroxy-6-oxo-6-sulfanylhexanoic acid.
| Compound Name | (2S,3S,4S,5R)-2,3,4,5-tetrahydroxy-6-oxo-6-sulfanylhexanoic acid |
|---|---|
| PubChem CID | 54314250 |
| Molecular Formula | C6H10O7S |
| Molecular Weight | 226.21 g/mol |
| Exact Mass | 226.01 |
| IUPAC Name | (2S,3S,4S,5R)-2,3,4,5-tetrahydroxy-6-oxo-6-sulfanylhexanoic acid |
| SMILES | O=C(O)[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C(=O)S |
| InChI | InChI=1S/C6H10O7S/c7-1(3(9)5(11)12)2(8)4(10)6(13)14/h1-4,7-10H,(H,11,12)(H,13,14)/t1-,2-,3-,4+/m0/s1 |
| InChIKey | SNAOTGNREUPZGJ-LLEIAEIESA-N |
| XLogP | -3.03 |
| TPSA | 135.29 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.21 |
| LogP ≤ 5 | -3.03 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|