About 1-(1,3,3-trimethyl-7-oxabicyclo[4.1.0]heptan-2-yl)but-2-en-1-one
1-(1,3,3-trimethyl-7-oxabicyclo[4.1.0]heptan-2-yl)but-2-en-1-one (PubChem CID 54314508) has the molecular formula C13H20O2
and a molecular weight of 208.30 g/mol. Its IUPAC name is 1-(1,3,3-trimethyl-7-oxabicyclo[4.1.0]heptan-2-yl)but-2-en-1-one.
Molecular Properties
| Compound Name | 1-(1,3,3-trimethyl-7-oxabicyclo[4.1.0]heptan-2-yl)but-2-en-1-one |
| PubChem CID | 54314508 |
| Molecular Formula | C13H20O2 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.15 |
| IUPAC Name | 1-(1,3,3-trimethyl-7-oxabicyclo[4.1.0]heptan-2-yl)but-2-en-1-one |
| SMILES | CC=CC(=O)C1C(C)(C)CCC2OC21C |
| InChI | InChI=1S/C13H20O2/c1-5-6-9(14)11-12(2,3)8-7-10-13(11,4)15-10/h5-6,10-11H,7-8H2,1-4H3 |
| InChIKey | SNFIWEHPAPQDAW-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 1-(1,3,3-trimethyl-7-oxabicyclo[4.1.0]heptan-2-yl)but-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,3,3-trimethyl-7-oxabicyclo[4.1.0]heptan-2-yl)but-2-en-1-one?
The IUPAC name of 1-(1,3,3-trimethyl-7-oxabicyclo[4.1.0]heptan-2-yl)but-2-en-1-one (CID 54314508) is 1-(1,3,3-trimethyl-7-oxabicyclo[4.1.0]heptan-2-yl)but-2-en-1-one.
What is the SMILES notation for 1-(1,3,3-trimethyl-7-oxabicyclo[4.1.0]heptan-2-yl)but-2-en-1-one?
The canonical SMILES for 1-(1,3,3-trimethyl-7-oxabicyclo[4.1.0]heptan-2-yl)but-2-en-1-one is CC=CC(=O)C1C(C)(C)CCC2OC21C.
What is the InChIKey of 1-(1,3,3-trimethyl-7-oxabicyclo[4.1.0]heptan-2-yl)but-2-en-1-one?
The InChIKey is SNFIWEHPAPQDAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20O2/c1-5-6-9(14)11-12(2,3)8-7-10-13(11,4)15-10/h5-6,10-11H,7-8H2,1-4H3.
What are the key properties of 1-(1,3,3-trimethyl-7-oxabicyclo[4.1.0]heptan-2-yl)but-2-en-1-one?
1-(1,3,3-trimethyl-7-oxabicyclo[4.1.0]heptan-2-yl)but-2-en-1-one has a molecular weight of 208.30 g/mol, XLogP of 2.73, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,3,3-trimethyl-7-oxabicyclo[4.1.0]heptan-2-yl)but-2-en-1-one is sourced from PubChem (CID 54314508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).