C23H17BrN2O4S — CID 5431474
[4-[(Z)-[1-(4-bromophenyl)-3-methyl-5-oxopyrazol-4-ylidene]methyl]-2-methoxyphenyl] thiophene-2-carboxylate (PubChem CID 5431474) has the molecular formula C23H17BrN2O4S and a molecular weight of 497.37 g/mol. Its IUPAC name is [4-[(Z)-[1-(4-bromophenyl)-3-methyl-5-oxopyrazol-4-ylidene]methyl]-2-methoxyphenyl] thiophene-2-carboxylate.
| Compound Name | [4-[(Z)-[1-(4-bromophenyl)-3-methyl-5-oxopyrazol-4-ylidene]methyl]-2-methoxyphenyl] thiophene-2-carboxylate |
|---|---|
| PubChem CID | 5431474 |
| Molecular Formula | C23H17BrN2O4S |
| Molecular Weight | 497.37 g/mol |
| Exact Mass | 496.01 |
| IUPAC Name | [4-[(Z)-[1-(4-bromophenyl)-3-methyl-5-oxopyrazol-4-ylidene]methyl]-2-methoxyphenyl] thiophene-2-carboxylate |
| SMILES | COc1cc(/C=C2\C(=O)N(c3ccc(Br)cc3)N=C2C)ccc1OC(=O)c1cccs1 |
| InChI | InChI=1S/C23H17BrN2O4S/c1-14-18(22(27)26(25-14)17-8-6-16(24)7-9-17)12-15-5-10-19(20(13-15)29-2)30-23(28)21-4-3-11-31-21/h3-13H,1-2H3/b18-12- |
| InChIKey | FQHQOLCADMRZFY-PDGQHHTCSA-N |
| XLogP | 5.54 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.37 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|