C29H29N5O4 — CID 54315289
N-[4-[2,7-dicyano-6-(ethylperoxymethyl)-1H-pyrrolo[1,2-a]imidazol-3-yl]phenyl]-2-(2,4-dimethylphenoxy)butanamide (PubChem CID 54315289) has the molecular formula C29H29N5O4 and a molecular weight of 511.58 g/mol. Its IUPAC name is N-[4-[2,7-dicyano-6-(ethylperoxymethyl)-1H-pyrrolo[1,2-a]imidazol-3-yl]phenyl]-2-(2,4-dimethylphenoxy)butanamide.
| Compound Name | N-[4-[2,7-dicyano-6-(ethylperoxymethyl)-1H-pyrrolo[1,2-a]imidazol-3-yl]phenyl]-2-(2,4-dimethylphenoxy)butanamide |
|---|---|
| PubChem CID | 54315289 |
| Molecular Formula | C29H29N5O4 |
| Molecular Weight | 511.58 g/mol |
| Exact Mass | 511.22 |
| IUPAC Name | N-[4-[2,7-dicyano-6-(ethylperoxymethyl)-1H-pyrrolo[1,2-a]imidazol-3-yl]phenyl]-2-(2,4-dimethylphenoxy)butanamide |
| SMILES | CCOOCc1cn2c(-c3ccc(NC(=O)C(CC)Oc4ccc(C)cc4C)cc3)c(C#N)[nH]c2c1C#N |
| InChI | InChI=1S/C29H29N5O4/c1-5-25(38-26-12-7-18(3)13-19(26)4)29(35)32-22-10-8-20(9-11-22)27-24(15-31)33-28-23(14-30)21(16-34(27)28)17-37-36-6-2/h7-13,16,25,33H,5-6,17H2,1-4H3,(H,32,35) |
| InChIKey | HLHYGZXLNRVRNB-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 124.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.58 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|