C14H15N3O6 — CID 54316310
4-hydroxy-N-(4-hydroxy-3-methoxyphenyl)-1,3-dimethyl-2,6-dioxopyrimidine-5-carboxamide (PubChem CID 54316310) has the molecular formula C14H15N3O6 and a molecular weight of 321.29 g/mol. Its IUPAC name is 4-hydroxy-N-(4-hydroxy-3-methoxyphenyl)-1,3-dimethyl-2,6-dioxopyrimidine-5-carboxamide.
| Compound Name | 4-hydroxy-N-(4-hydroxy-3-methoxyphenyl)-1,3-dimethyl-2,6-dioxopyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 54316310 |
| Molecular Formula | C14H15N3O6 |
| Molecular Weight | 321.29 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | 4-hydroxy-N-(4-hydroxy-3-methoxyphenyl)-1,3-dimethyl-2,6-dioxopyrimidine-5-carboxamide |
| SMILES | COc1cc(NC(=O)c2c(O)n(C)c(=O)n(C)c2=O)ccc1O |
| InChI | InChI=1S/C14H15N3O6/c1-16-12(20)10(13(21)17(2)14(16)22)11(19)15-7-4-5-8(18)9(6-7)23-3/h4-6,18,20H,1-3H3,(H,15,19) |
| InChIKey | SOKSSUHWZDXHRQ-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 122.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.29 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|