C18H16F3N5O2 — CID 54316534
(1,3-dimethyl-5-prop-2-enoxypyrazol-4-yl)-[4-(1,2,4-triazol-1-yl)-2-(trifluoromethyl)phenyl]methanone (PubChem CID 54316534) has the molecular formula C18H16F3N5O2 and a molecular weight of 391.35 g/mol. Its IUPAC name is (1,3-dimethyl-5-prop-2-enoxypyrazol-4-yl)-[4-(1,2,4-triazol-1-yl)-2-(trifluoromethyl)phenyl]methanone.
| Compound Name | (1,3-dimethyl-5-prop-2-enoxypyrazol-4-yl)-[4-(1,2,4-triazol-1-yl)-2-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 54316534 |
| Molecular Formula | C18H16F3N5O2 |
| Molecular Weight | 391.35 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | (1,3-dimethyl-5-prop-2-enoxypyrazol-4-yl)-[4-(1,2,4-triazol-1-yl)-2-(trifluoromethyl)phenyl]methanone |
| SMILES | C=CCOc1c(C(=O)c2ccc(-n3cncn3)cc2C(F)(F)F)c(C)nn1C |
| InChI | InChI=1S/C18H16F3N5O2/c1-4-7-28-17-15(11(2)24-25(17)3)16(27)13-6-5-12(26-10-22-9-23-26)8-14(13)18(19,20)21/h4-6,8-10H,1,7H2,2-3H3 |
| InChIKey | SOPAPXHAUBFAJC-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 74.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.35 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|