About 4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-2-amine
4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-2-amine (PubChem CID 54316662) has the molecular formula C7H11N3
and a molecular weight of 137.19 g/mol. Its IUPAC name is 4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-2-amine.
Analyze 4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-2-amine?
The IUPAC name of 4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-2-amine (CID 54316662) is 4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-2-amine.
What is the SMILES notation for 4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-2-amine?
The canonical SMILES for 4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-2-amine is Nc1cc2n(n1)CCCC2.
What is the InChIKey of 4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-2-amine?
The InChIKey is SORKKBJRYUWSHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N3/c8-7-5-6-3-1-2-4-10(6)9-7/h5H,1-4H2,(H2,8,9).
What are the key properties of 4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-2-amine?
4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-2-amine has a molecular weight of 137.19 g/mol, XLogP of 0.80, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-2-amine is sourced from PubChem (CID 54316662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).