C8H10ClNO3 — CID 54317016
2-[4-chloro-1-(2-hydroxyethyl)pyrrol-2-yl]acetic acid (PubChem CID 54317016) has the molecular formula C8H10ClNO3 and a molecular weight of 203.62 g/mol. Its IUPAC name is 2-[4-chloro-1-(2-hydroxyethyl)pyrrol-2-yl]acetic acid.
| Compound Name | 2-[4-chloro-1-(2-hydroxyethyl)pyrrol-2-yl]acetic acid |
|---|---|
| PubChem CID | 54317016 |
| Molecular Formula | C8H10ClNO3 |
| Molecular Weight | 203.62 g/mol |
| Exact Mass | 203.03 |
| IUPAC Name | 2-[4-chloro-1-(2-hydroxyethyl)pyrrol-2-yl]acetic acid |
| SMILES | O=C(O)Cc1cc(Cl)cn1CCO |
| InChI | InChI=1S/C8H10ClNO3/c9-6-3-7(4-8(12)13)10(5-6)1-2-11/h3,5,11H,1-2,4H2,(H,12,13) |
| InChIKey | SOXUOCPRYINPIH-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.62 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |