About 6-methyl-5H-imidazo[1,2-b]pyrazole
6-methyl-5H-imidazo[1,2-b]pyrazole (PubChem CID 543171) has the molecular formula C6H7N3
and a molecular weight of 121.14 g/mol. Its IUPAC name is 6-methyl-5H-imidazo[1,2-b]pyrazole.
Molecular Properties
| Compound Name | 6-methyl-5H-imidazo[1,2-b]pyrazole |
| PubChem CID | 543171 |
| Molecular Formula | C6H7N3 |
| Molecular Weight | 121.14 g/mol |
| Exact Mass | 121.06 |
| IUPAC Name | 6-methyl-5H-imidazo[1,2-b]pyrazole |
| SMILES | Cc1cc2nccn2[nH]1 |
| InChI | InChI=1S/C6H7N3/c1-5-4-6-7-2-3-9(6)8-5/h2-4,8H,1H3 |
| InChIKey | FQBWCTIOVJKGIP-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 121.14 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-methyl-5H-imidazo[1,2-b]pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-5H-imidazo[1,2-b]pyrazole?
The IUPAC name of 6-methyl-5H-imidazo[1,2-b]pyrazole (CID 543171) is 6-methyl-5H-imidazo[1,2-b]pyrazole.
What is the SMILES notation for 6-methyl-5H-imidazo[1,2-b]pyrazole?
The canonical SMILES for 6-methyl-5H-imidazo[1,2-b]pyrazole is Cc1cc2nccn2[nH]1.
What is the InChIKey of 6-methyl-5H-imidazo[1,2-b]pyrazole?
The InChIKey is FQBWCTIOVJKGIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N3/c1-5-4-6-7-2-3-9(6)8-5/h2-4,8H,1H3.
What are the key properties of 6-methyl-5H-imidazo[1,2-b]pyrazole?
6-methyl-5H-imidazo[1,2-b]pyrazole has a molecular weight of 121.14 g/mol, XLogP of 0.97, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-5H-imidazo[1,2-b]pyrazole is sourced from PubChem (CID 543171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).