C24H28N6O3 — CID 54317429
N-(3,9-dimethyl-3,9-diazabicyclo[3.3.1]nonan-7-yl)-1-[(4-nitrophenyl)methyl]indazole-3-carboxamide (PubChem CID 54317429) has the molecular formula C24H28N6O3 and a molecular weight of 448.53 g/mol. Its IUPAC name is N-(3,9-dimethyl-3,9-diazabicyclo[3.3.1]nonan-7-yl)-1-[(4-nitrophenyl)methyl]indazole-3-carboxamide.
| Compound Name | N-(3,9-dimethyl-3,9-diazabicyclo[3.3.1]nonan-7-yl)-1-[(4-nitrophenyl)methyl]indazole-3-carboxamide |
|---|---|
| PubChem CID | 54317429 |
| Molecular Formula | C24H28N6O3 |
| Molecular Weight | 448.53 g/mol |
| Exact Mass | 448.22 |
| IUPAC Name | N-(3,9-dimethyl-3,9-diazabicyclo[3.3.1]nonan-7-yl)-1-[(4-nitrophenyl)methyl]indazole-3-carboxamide |
| SMILES | CN1CC2CC(NC(=O)c3nn(Cc4ccc([N+](=O)[O-])cc4)c4ccccc34)CC(C1)N2C |
| InChI | InChI=1S/C24H28N6O3/c1-27-14-19-11-17(12-20(15-27)28(19)2)25-24(31)23-21-5-3-4-6-22(21)29(26-23)13-16-7-9-18(10-8-16)30(32)33/h3-10,17,19-20H,11-15H2,1-2H3,(H,25,31) |
| InChIKey | SPFDQMYQPLMEEX-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 96.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.53 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|