About 6-iodo-2,4-dimethylhept-2-en-1-ol
6-iodo-2,4-dimethylhept-2-en-1-ol (PubChem CID 54317872) has the molecular formula C9H17IO
and a molecular weight of 268.14 g/mol. Its IUPAC name is 6-iodo-2,4-dimethylhept-2-en-1-ol.
Molecular Properties
| Compound Name | 6-iodo-2,4-dimethylhept-2-en-1-ol |
| PubChem CID | 54317872 |
| Molecular Formula | C9H17IO |
| Molecular Weight | 268.14 g/mol |
| Exact Mass | 268.03 |
| IUPAC Name | 6-iodo-2,4-dimethylhept-2-en-1-ol |
| SMILES | CC(=CC(C)CC(C)I)CO |
| InChI | InChI=1S/C9H17IO/c1-7(5-9(3)10)4-8(2)6-11/h4,7,9,11H,5-6H2,1-3H3 |
| InChIKey | RDVJSOBRLNEZPA-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.14 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-iodo-2,4-dimethylhept-2-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-iodo-2,4-dimethylhept-2-en-1-ol?
The IUPAC name of 6-iodo-2,4-dimethylhept-2-en-1-ol (CID 54317872) is 6-iodo-2,4-dimethylhept-2-en-1-ol.
What is the SMILES notation for 6-iodo-2,4-dimethylhept-2-en-1-ol?
The canonical SMILES for 6-iodo-2,4-dimethylhept-2-en-1-ol is CC(=CC(C)CC(C)I)CO.
What is the InChIKey of 6-iodo-2,4-dimethylhept-2-en-1-ol?
The InChIKey is RDVJSOBRLNEZPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17IO/c1-7(5-9(3)10)4-8(2)6-11/h4,7,9,11H,5-6H2,1-3H3.
What are the key properties of 6-iodo-2,4-dimethylhept-2-en-1-ol?
6-iodo-2,4-dimethylhept-2-en-1-ol has a molecular weight of 268.14 g/mol, XLogP of 2.77, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-iodo-2,4-dimethylhept-2-en-1-ol is sourced from PubChem (CID 54317872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).