About 3,7-dimethyloct-6-enyl 11-[dimethyl(trimethylsilyloxy)silyl]undecanoate
3,7-dimethyloct-6-enyl 11-[dimethyl(trimethylsilyloxy)silyl]undecanoate (PubChem CID 54318200) has the molecular formula C26H54O3Si2
and a molecular weight of 470.89 g/mol. Its IUPAC name is 3,7-dimethyloct-6-enyl 11-[dimethyl(trimethylsilyloxy)silyl]undecanoate.
Molecular Properties
| Compound Name | 3,7-dimethyloct-6-enyl 11-[dimethyl(trimethylsilyloxy)silyl]undecanoate |
| PubChem CID | 54318200 |
| Molecular Formula | C26H54O3Si2 |
| Molecular Weight | 470.89 g/mol |
| Exact Mass | 470.36 |
| IUPAC Name | 3,7-dimethyloct-6-enyl 11-[dimethyl(trimethylsilyloxy)silyl]undecanoate |
| SMILES | CC(C)=CCCC(C)CCOC(=O)CCCCCCCCCC[Si](C)(C)O[Si](C)(C)C |
| InChI | InChI=1S/C26H54O3Si2/c1-24(2)18-17-19-25(3)21-22-28-26(27)20-15-13-11-9-10-12-14-16-23-31(7,8)29-30(4,5)6/h18,25H,9-17,19-23H2,1-8H3 |
| InChIKey | SPSWGGNUCZTBNZ-UHFFFAOYSA-N |
| XLogP | 8.87 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 470.89 |
| LogP ≤ 5 | 8.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3,7-dimethyloct-6-enyl 11-[dimethyl(trimethylsilyloxy)silyl]undecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,7-dimethyloct-6-enyl 11-[dimethyl(trimethylsilyloxy)silyl]undecanoate?
The IUPAC name of 3,7-dimethyloct-6-enyl 11-[dimethyl(trimethylsilyloxy)silyl]undecanoate (CID 54318200) is 3,7-dimethyloct-6-enyl 11-[dimethyl(trimethylsilyloxy)silyl]undecanoate.
What is the SMILES notation for 3,7-dimethyloct-6-enyl 11-[dimethyl(trimethylsilyloxy)silyl]undecanoate?
The canonical SMILES for 3,7-dimethyloct-6-enyl 11-[dimethyl(trimethylsilyloxy)silyl]undecanoate is CC(C)=CCCC(C)CCOC(=O)CCCCCCCCCC[Si](C)(C)O[Si](C)(C)C.
What is the InChIKey of 3,7-dimethyloct-6-enyl 11-[dimethyl(trimethylsilyloxy)silyl]undecanoate?
The InChIKey is SPSWGGNUCZTBNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H54O3Si2/c1-24(2)18-17-19-25(3)21-22-28-26(27)20-15-13-11-9-10-12-14-16-23-31(7,8)29-30(4,5)6/h18,25H,9-17,19-23H2,1-8H3.
What are the key properties of 3,7-dimethyloct-6-enyl 11-[dimethyl(trimethylsilyloxy)silyl]undecanoate?
3,7-dimethyloct-6-enyl 11-[dimethyl(trimethylsilyloxy)silyl]undecanoate has a molecular weight of 470.89 g/mol, XLogP of 8.87, 19 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,7-dimethyloct-6-enyl 11-[dimethyl(trimethylsilyloxy)silyl]undecanoate is sourced from PubChem (CID 54318200), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).