C42H43ClN4O11S2 — CID 54318654
ethyl 2-[2-[[3-[(4-tert-butyl-1,3-thiazol-2-yl)methoxy]-5-[(4-nitrophenyl)methoxycarbonylamino]benzoyl]amino]-4-[3-(4-chlorophenyl)sulfonylpropyl]phenoxy]acetate (PubChem CID 54318654) has the molecular formula C42H43ClN4O11S2 and a molecular weight of 879.41 g/mol. Its IUPAC name is ethyl 2-[2-[[3-[(4-tert-butyl-1,3-thiazol-2-yl)methoxy]-5-[(4-nitrophenyl)methoxycarbonylamino]benzoyl]amino]-4-[3-(4-chlorophenyl)sulfonylpropyl]phenoxy]acetate.
| Compound Name | ethyl 2-[2-[[3-[(4-tert-butyl-1,3-thiazol-2-yl)methoxy]-5-[(4-nitrophenyl)methoxycarbonylamino]benzoyl]amino]-4-[3-(4-chlorophenyl)sulfonylpropyl]phenoxy]acetate |
|---|---|
| PubChem CID | 54318654 |
| Molecular Formula | C42H43ClN4O11S2 |
| Molecular Weight | 879.41 g/mol |
| Exact Mass | 878.21 |
| IUPAC Name | ethyl 2-[2-[[3-[(4-tert-butyl-1,3-thiazol-2-yl)methoxy]-5-[(4-nitrophenyl)methoxycarbonylamino]benzoyl]amino]-4-[3-(4-chlorophenyl)sulfonylpropyl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1ccc(CCCS(=O)(=O)c2ccc(Cl)cc2)cc1NC(=O)c1cc(NC(=O)OCc2ccc([N+](=O)[O-])cc2)cc(OCc2nc(C(C)(C)C)cs2)c1 |
| InChI | InChI=1S/C42H43ClN4O11S2/c1-5-55-39(48)25-57-36-17-10-27(7-6-18-60(53,54)34-15-11-30(43)12-16-34)19-35(36)45-40(49)29-20-31(44-41(50)58-23-28-8-13-32(14-9-28)47(51)52)22-33(21-29)56-24-38-46-37(26-59-38)42(2,3)4/h8-17,19-22,26H,5-7,18,23-25H2,1-4H3,(H,44,50)(H,45,49) |
| InChIKey | SQAVHLAXOKZMNU-UHFFFAOYSA-N |
| XLogP | 8.93 |
| TPSA | 202.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 879.41 |
| LogP ≤ 5 | 8.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|