C12H12ClN3O — CID 54318749
3-[3-(4-chlorophenyl)-5-methyl-1,2,4-triazol-1-yl]propanal (PubChem CID 54318749) has the molecular formula C12H12ClN3O and a molecular weight of 249.70 g/mol. Its IUPAC name is 3-[3-(4-chlorophenyl)-5-methyl-1,2,4-triazol-1-yl]propanal.
| Compound Name | 3-[3-(4-chlorophenyl)-5-methyl-1,2,4-triazol-1-yl]propanal |
|---|---|
| PubChem CID | 54318749 |
| Molecular Formula | C12H12ClN3O |
| Molecular Weight | 249.70 g/mol |
| Exact Mass | 249.07 |
| IUPAC Name | 3-[3-(4-chlorophenyl)-5-methyl-1,2,4-triazol-1-yl]propanal |
| SMILES | Cc1nc(-c2ccc(Cl)cc2)nn1CCC=O |
| InChI | InChI=1S/C12H12ClN3O/c1-9-14-12(15-16(9)7-2-8-17)10-3-5-11(13)6-4-10/h3-6,8H,2,7H2,1H3 |
| InChIKey | SQCJQMQLGYFBFE-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.70 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|