C26H50O7 — CID 54318762
(2S,3R,4S,5R)-6-decoxy-6-decyl-3,4,5-trihydroxyoxane-2-carboxylic acid (PubChem CID 54318762) has the molecular formula C26H50O7 and a molecular weight of 474.68 g/mol. Its IUPAC name is (2S,3R,4S,5R)-6-decoxy-6-decyl-3,4,5-trihydroxyoxane-2-carboxylic acid.
| Compound Name | (2S,3R,4S,5R)-6-decoxy-6-decyl-3,4,5-trihydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 54318762 |
| Molecular Formula | C26H50O7 |
| Molecular Weight | 474.68 g/mol |
| Exact Mass | 474.36 |
| IUPAC Name | (2S,3R,4S,5R)-6-decoxy-6-decyl-3,4,5-trihydroxyoxane-2-carboxylic acid |
| SMILES | CCCCCCCCCCOC1(CCCCCCCCCC)O[C@H](C(=O)O)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C26H50O7/c1-3-5-7-9-11-13-15-17-19-26(32-20-18-16-14-12-10-8-6-4-2)24(29)22(28)21(27)23(33-26)25(30)31/h21-24,27-29H,3-20H2,1-2H3,(H,30,31)/t21-,22+,23+,24-,26?/m1/s1 |
| InChIKey | SQCOWVNLLODHKA-BIUNDPQUSA-N |
| XLogP | 4.94 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.68 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|