C12H19NO — CID 54319063
5,5,8a-trimethyl-2,3,7,8-tetrahydro-1H-isoquinolin-6-one (PubChem CID 54319063) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is 5,5,8a-trimethyl-2,3,7,8-tetrahydro-1H-isoquinolin-6-one.
| Compound Name | 5,5,8a-trimethyl-2,3,7,8-tetrahydro-1H-isoquinolin-6-one |
|---|---|
| PubChem CID | 54319063 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | 5,5,8a-trimethyl-2,3,7,8-tetrahydro-1H-isoquinolin-6-one |
| SMILES | CC12CCC(=O)C(C)(C)C1=CCNC2 |
| InChI | InChI=1S/C12H19NO/c1-11(2)9-5-7-13-8-12(9,3)6-4-10(11)14/h5,13H,4,6-8H2,1-3H3 |
| InChIKey | SQHZIBFHRSSVLK-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|