C10H18O9 — CID 54319258
4-oxo-4-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexoxy]butanoic acid (PubChem CID 54319258) has the molecular formula C10H18O9 and a molecular weight of 282.25 g/mol. Its IUPAC name is 4-oxo-4-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexoxy]butanoic acid.
| Compound Name | 4-oxo-4-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexoxy]butanoic acid |
|---|---|
| PubChem CID | 54319258 |
| Molecular Formula | C10H18O9 |
| Molecular Weight | 282.25 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 4-oxo-4-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexoxy]butanoic acid |
| SMILES | O=C(O)CCC(=O)OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C10H18O9/c11-3-5(12)9(17)10(18)6(13)4-19-8(16)2-1-7(14)15/h5-6,9-13,17-18H,1-4H2,(H,14,15)/t5-,6+,9-,10-/m1/s1 |
| InChIKey | SQLSUCRRBLLJNU-MLTZYSBQSA-N |
| XLogP | -3.17 |
| TPSA | 164.75 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.25 |
| LogP ≤ 5 | -3.17 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |