C40H33N5O10S4 — CID 54319382
4,5,6,7-tetrakis[(4-nitrophenyl)sulfanyl]-2-octylisoindole-1,3-dione (PubChem CID 54319382) has the molecular formula C40H33N5O10S4 and a molecular weight of 872.00 g/mol. Its IUPAC name is 4,5,6,7-tetrakis[(4-nitrophenyl)sulfanyl]-2-octylisoindole-1,3-dione.
| Compound Name | 4,5,6,7-tetrakis[(4-nitrophenyl)sulfanyl]-2-octylisoindole-1,3-dione |
|---|---|
| PubChem CID | 54319382 |
| Molecular Formula | C40H33N5O10S4 |
| Molecular Weight | 872.00 g/mol |
| Exact Mass | 871.11 |
| IUPAC Name | 4,5,6,7-tetrakis[(4-nitrophenyl)sulfanyl]-2-octylisoindole-1,3-dione |
| SMILES | CCCCCCCCN1C(=O)c2c(Sc3ccc([N+](=O)[O-])cc3)c(Sc3ccc([N+](=O)[O-])cc3)c(Sc3ccc([N+](=O)[O-])cc3)c(Sc3ccc([N+](=O)[O-])cc3)c2C1=O |
| InChI | InChI=1S/C40H33N5O10S4/c1-2-3-4-5-6-7-24-41-39(46)33-34(40(41)47)36(57-30-18-10-26(11-19-30)43(50)51)38(59-32-22-14-28(15-23-32)45(54)55)37(58-31-20-12-27(13-21-31)44(52)53)35(33)56-29-16-8-25(9-17-29)42(48)49/h8-23H,2-7,24H2,1H3 |
| InChIKey | SQOAJPVHIVIVGL-UHFFFAOYSA-N |
| XLogP | 11.88 |
| TPSA | 209.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 872.00 |
| LogP ≤ 5 | 11.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|