C16H33I — CID 54319462
(E)-1-iodooct-1-ene;2,2,3,3-tetramethylbutane (PubChem CID 54319462) has the molecular formula C16H33I and a molecular weight of 352.34 g/mol. Its IUPAC name is (E)-1-iodooct-1-ene;2,2,3,3-tetramethylbutane.
| Compound Name | (E)-1-iodooct-1-ene;2,2,3,3-tetramethylbutane |
|---|---|
| PubChem CID | 54319462 |
| Molecular Formula | C16H33I |
| Molecular Weight | 352.34 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | (E)-1-iodooct-1-ene;2,2,3,3-tetramethylbutane |
| SMILES | CC(C)(C)C(C)(C)C.CCCCCC/C=C/I |
| InChI | InChI=1S/C8H15I.C8H18/c1-2-3-4-5-6-7-8-9;1-7(2,3)8(4,5)6/h7-8H,2-6H2,1H3;1-6H3/b8-7+; |
| InChIKey | SQPITNQKJKJOHW-USRGLUTNSA-N |
| XLogP | 6.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.34 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|