About 3-[[(2S,4S)-4-fluoro-1-methylpyrrolidin-2-yl]methoxy]pyridine
3-[[(2S,4S)-4-fluoro-1-methylpyrrolidin-2-yl]methoxy]pyridine (PubChem CID 54319796) has the molecular formula C11H15FN2O
and a molecular weight of 210.25 g/mol. Its IUPAC name is 3-[[(2S,4S)-4-fluoro-1-methylpyrrolidin-2-yl]methoxy]pyridine.
Molecular Properties
| Compound Name | 3-[[(2S,4S)-4-fluoro-1-methylpyrrolidin-2-yl]methoxy]pyridine |
| PubChem CID | 54319796 |
| Molecular Formula | C11H15FN2O |
| Molecular Weight | 210.25 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | 3-[[(2S,4S)-4-fluoro-1-methylpyrrolidin-2-yl]methoxy]pyridine |
| SMILES | CN1C[C@@H](F)C[C@H]1COc1cccnc1 |
| InChI | InChI=1S/C11H15FN2O/c1-14-7-9(12)5-10(14)8-15-11-3-2-4-13-6-11/h2-4,6,9-10H,5,7-8H2,1H3/t9-,10-/m0/s1 |
| InChIKey | SQUZDPPCXZMFIC-UWVGGRQHSA-N |
| XLogP | 1.50 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.25 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[[(2S,4S)-4-fluoro-1-methylpyrrolidin-2-yl]methoxy]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[(2S,4S)-4-fluoro-1-methylpyrrolidin-2-yl]methoxy]pyridine?
The IUPAC name of 3-[[(2S,4S)-4-fluoro-1-methylpyrrolidin-2-yl]methoxy]pyridine (CID 54319796) is 3-[[(2S,4S)-4-fluoro-1-methylpyrrolidin-2-yl]methoxy]pyridine.
What is the SMILES notation for 3-[[(2S,4S)-4-fluoro-1-methylpyrrolidin-2-yl]methoxy]pyridine?
The canonical SMILES for 3-[[(2S,4S)-4-fluoro-1-methylpyrrolidin-2-yl]methoxy]pyridine is CN1C[C@@H](F)C[C@H]1COc1cccnc1.
What is the InChIKey of 3-[[(2S,4S)-4-fluoro-1-methylpyrrolidin-2-yl]methoxy]pyridine?
The InChIKey is SQUZDPPCXZMFIC-UWVGGRQHSA-N. The full InChI is InChI=1S/C11H15FN2O/c1-14-7-9(12)5-10(14)8-15-11-3-2-4-13-6-11/h2-4,6,9-10H,5,7-8H2,1H3/t9-,10-/m0/s1.
What are the key properties of 3-[[(2S,4S)-4-fluoro-1-methylpyrrolidin-2-yl]methoxy]pyridine?
3-[[(2S,4S)-4-fluoro-1-methylpyrrolidin-2-yl]methoxy]pyridine has a molecular weight of 210.25 g/mol, XLogP of 1.50, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[(2S,4S)-4-fluoro-1-methylpyrrolidin-2-yl]methoxy]pyridine is sourced from PubChem (CID 54319796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).