C45H84N2O6 — CID 54319875
N-[(3R,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-[octadec-9-enoyl(propyl)amino]oxan-3-yl]octadec-9-enamide (PubChem CID 54319875) has the molecular formula C45H84N2O6 and a molecular weight of 749.17 g/mol. Its IUPAC name is N-[(3R,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-[octadec-9-enoyl(propyl)amino]oxan-3-yl]octadec-9-enamide.
| Compound Name | N-[(3R,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-[octadec-9-enoyl(propyl)amino]oxan-3-yl]octadec-9-enamide |
|---|---|
| PubChem CID | 54319875 |
| Molecular Formula | C45H84N2O6 |
| Molecular Weight | 749.17 g/mol |
| Exact Mass | 748.63 |
| IUPAC Name | N-[(3R,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-[octadec-9-enoyl(propyl)amino]oxan-3-yl]octadec-9-enamide |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)N[C@H]1C(N(CCC)C(=O)CCCCCCCC=CCCCCCCCC)O[C@H](CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C45H84N2O6/c1-4-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-40(49)46-42-44(52)43(51)39(38-48)53-45(42)47(37-6-3)41(50)36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-5-2/h19-22,39,42-45,48,51-52H,4-18,23-38H2,1-3H3,(H,46,49)/t39-,42-,43-,44-,45?/m1/s1 |
| InChIKey | SQWHTGUQTKKTFE-UXNWKBKMSA-N |
| XLogP | 10.22 |
| TPSA | 119.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.17 |
| LogP ≤ 5 | 10.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|