C18H33N — CID 54320004
N-ethyl-3,7,11-trimethyltrideca-2,4,10-trien-1-amine (PubChem CID 54320004) has the molecular formula C18H33N and a molecular weight of 263.47 g/mol. Its IUPAC name is N-ethyl-3,7,11-trimethyltrideca-2,4,10-trien-1-amine.
| Compound Name | N-ethyl-3,7,11-trimethyltrideca-2,4,10-trien-1-amine |
|---|---|
| PubChem CID | 54320004 |
| Molecular Formula | C18H33N |
| Molecular Weight | 263.47 g/mol |
| Exact Mass | 263.26 |
| IUPAC Name | N-ethyl-3,7,11-trimethyltrideca-2,4,10-trien-1-amine |
| SMILES | CCNCC=C(C)C=CCC(C)CCC=C(C)CC |
| InChI | InChI=1S/C18H33N/c1-6-16(3)10-8-11-17(4)12-9-13-18(5)14-15-19-7-2/h9-10,13-14,17,19H,6-8,11-12,15H2,1-5H3 |
| InChIKey | SQYLSMZTBSCDGJ-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.47 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|