C18H26O6 — CID 54320228
2-(6,10-dimethylundeca-1,5,9-trien-2-yl)-1,3-dioxolane-4,5-dicarboxylic acid (PubChem CID 54320228) has the molecular formula C18H26O6 and a molecular weight of 338.40 g/mol. Its IUPAC name is 2-(6,10-dimethylundeca-1,5,9-trien-2-yl)-1,3-dioxolane-4,5-dicarboxylic acid.
| Compound Name | 2-(6,10-dimethylundeca-1,5,9-trien-2-yl)-1,3-dioxolane-4,5-dicarboxylic acid |
|---|---|
| PubChem CID | 54320228 |
| Molecular Formula | C18H26O6 |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | 2-(6,10-dimethylundeca-1,5,9-trien-2-yl)-1,3-dioxolane-4,5-dicarboxylic acid |
| SMILES | C=C(CCC=C(C)CCC=C(C)C)C1OC(C(=O)O)C(C(=O)O)O1 |
| InChI | InChI=1S/C18H26O6/c1-11(2)7-5-8-12(3)9-6-10-13(4)18-23-14(16(19)20)15(24-18)17(21)22/h7,9,14-15,18H,4-6,8,10H2,1-3H3,(H,19,20)(H,21,22) |
| InChIKey | SRDBLQHXTRKFEJ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|