About 3-[4-(4-fluorobenzoyl)piperidin-1-yl]propyl N-(1,3-benzoxazol-5-yl)carbamate
3-[4-(4-fluorobenzoyl)piperidin-1-yl]propyl N-(1,3-benzoxazol-5-yl)carbamate (PubChem CID 54320635) has the molecular formula C23H24FN3O4
and a molecular weight of 425.46 g/mol. Its IUPAC name is 3-[4-(4-fluorobenzoyl)piperidin-1-yl]propyl N-(1,3-benzoxazol-5-yl)carbamate.
Molecular Properties
| Compound Name | 3-[4-(4-fluorobenzoyl)piperidin-1-yl]propyl N-(1,3-benzoxazol-5-yl)carbamate |
| PubChem CID | 54320635 |
| Molecular Formula | C23H24FN3O4 |
| Molecular Weight | 425.46 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | 3-[4-(4-fluorobenzoyl)piperidin-1-yl]propyl N-(1,3-benzoxazol-5-yl)carbamate |
| SMILES | O=C(Nc1ccc2ocnc2c1)OCCCN1CCC(C(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C23H24FN3O4/c24-18-4-2-16(3-5-18)22(28)17-8-11-27(12-9-17)10-1-13-30-23(29)26-19-6-7-21-20(14-19)25-15-31-21/h2-7,14-15,17H,1,8-13H2,(H,26,29) |
| InChIKey | SRJPLNQDONMNNN-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 84.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 425.46 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[4-(4-fluorobenzoyl)piperidin-1-yl]propyl N-(1,3-benzoxazol-5-yl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(4-fluorobenzoyl)piperidin-1-yl]propyl N-(1,3-benzoxazol-5-yl)carbamate?
The IUPAC name of 3-[4-(4-fluorobenzoyl)piperidin-1-yl]propyl N-(1,3-benzoxazol-5-yl)carbamate (CID 54320635) is 3-[4-(4-fluorobenzoyl)piperidin-1-yl]propyl N-(1,3-benzoxazol-5-yl)carbamate.
What is the SMILES notation for 3-[4-(4-fluorobenzoyl)piperidin-1-yl]propyl N-(1,3-benzoxazol-5-yl)carbamate?
The canonical SMILES for 3-[4-(4-fluorobenzoyl)piperidin-1-yl]propyl N-(1,3-benzoxazol-5-yl)carbamate is O=C(Nc1ccc2ocnc2c1)OCCCN1CCC(C(=O)c2ccc(F)cc2)CC1.
What is the InChIKey of 3-[4-(4-fluorobenzoyl)piperidin-1-yl]propyl N-(1,3-benzoxazol-5-yl)carbamate?
The InChIKey is SRJPLNQDONMNNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H24FN3O4/c24-18-4-2-16(3-5-18)22(28)17-8-11-27(12-9-17)10-1-13-30-23(29)26-19-6-7-21-20(14-19)25-15-31-21/h2-7,14-15,17H,1,8-13H2,(H,26,29).
What are the key properties of 3-[4-(4-fluorobenzoyl)piperidin-1-yl]propyl N-(1,3-benzoxazol-5-yl)carbamate?
3-[4-(4-fluorobenzoyl)piperidin-1-yl]propyl N-(1,3-benzoxazol-5-yl)carbamate has a molecular weight of 425.46 g/mol, XLogP of 4.50, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(4-fluorobenzoyl)piperidin-1-yl]propyl N-(1,3-benzoxazol-5-yl)carbamate is sourced from PubChem (CID 54320635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).