C42H35N3O5 — CID 54320871
4-[[[2-[(3S,11aS)-3-benzyl-1,4-dioxo-3,6,11,11a-tetrahydropyrazino[1,2-b]isoquinolin-2-yl]-2-(9H-fluoren-3-yl)acetyl]amino]methyl]benzoic acid (PubChem CID 54320871) has the molecular formula C42H35N3O5 and a molecular weight of 661.76 g/mol. Its IUPAC name is 4-[[[2-[(3S,11aS)-3-benzyl-1,4-dioxo-3,6,11,11a-tetrahydropyrazino[1,2-b]isoquinolin-2-yl]-2-(9H-fluoren-3-yl)acetyl]amino]methyl]benzoic acid.
| Compound Name | 4-[[[2-[(3S,11aS)-3-benzyl-1,4-dioxo-3,6,11,11a-tetrahydropyrazino[1,2-b]isoquinolin-2-yl]-2-(9H-fluoren-3-yl)acetyl]amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 54320871 |
| Molecular Formula | C42H35N3O5 |
| Molecular Weight | 661.76 g/mol |
| Exact Mass | 661.26 |
| IUPAC Name | 4-[[[2-[(3S,11aS)-3-benzyl-1,4-dioxo-3,6,11,11a-tetrahydropyrazino[1,2-b]isoquinolin-2-yl]-2-(9H-fluoren-3-yl)acetyl]amino]methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CNC(=O)C(c2ccc3c(c2)-c2ccccc2C3)N2C(=O)[C@@H]3Cc4ccccc4CN3C(=O)[C@@H]2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C42H35N3O5/c46-39(43-24-27-14-16-28(17-15-27)42(49)50)38(32-19-18-31-21-30-11-6-7-13-34(30)35(31)22-32)45-37(20-26-8-2-1-3-9-26)40(47)44-25-33-12-5-4-10-29(33)23-36(44)41(45)48/h1-19,22,36-38H,20-21,23-25H2,(H,43,46)(H,49,50)/t36-,37-,38?/m0/s1 |
| InChIKey | SROJGCQBAGERAV-CYQHNISFSA-N |
| XLogP | 5.72 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.76 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |