2-oxohex-5-enoic acid

C6H8O3 — CID 54321116

IUPAC2-oxohex-5-enoic acid
SMILESC=CCCC(=O)C(=O)O
InChIInChI=1S/C6H8O3/c1-2-3-4-5(7)6(8)9/h2H,1,3-4H2,(H,8,9)
InChIKeySRSUTBIWADPHRS-UHFFFAOYSA-N
MW128.13 g/mol
LogP0.61
Rot. Bonds4

About 2-oxohex-5-enoic acid

2-oxohex-5-enoic acid (PubChem CID 54321116) has the molecular formula C6H8O3 and a molecular weight of 128.13 g/mol. Its IUPAC name is 2-oxohex-5-enoic acid.

Molecular Properties

Compound Name2-oxohex-5-enoic acid
PubChem CID54321116
Molecular FormulaC6H8O3
Molecular Weight128.13 g/mol
Exact Mass128.05
IUPAC Name2-oxohex-5-enoic acid
SMILESC=CCCC(=O)C(=O)O
InChIInChI=1S/C6H8O3/c1-2-3-4-5(7)6(8)9/h2H,1,3-4H2,(H,8,9)
InChIKeySRSUTBIWADPHRS-UHFFFAOYSA-N
XLogP0.61
TPSA54.37 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms9
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500128.13
LogP ≤ 50.61
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze 2-oxohex-5-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-oxohex-5-enoic acid?
The IUPAC name of 2-oxohex-5-enoic acid (CID 54321116) is 2-oxohex-5-enoic acid.
What is the SMILES notation for 2-oxohex-5-enoic acid?
The canonical SMILES for 2-oxohex-5-enoic acid is C=CCCC(=O)C(=O)O.
What is the InChIKey of 2-oxohex-5-enoic acid?
The InChIKey is SRSUTBIWADPHRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8O3/c1-2-3-4-5(7)6(8)9/h2H,1,3-4H2,(H,8,9).
What are the key properties of 2-oxohex-5-enoic acid?
2-oxohex-5-enoic acid has a molecular weight of 128.13 g/mol, XLogP of 0.61, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxohex-5-enoic acid is sourced from PubChem (CID 54321116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).