About 1-(3-bromoprop-1-enyl)-3,5-dichlorobenzene
1-(3-bromoprop-1-enyl)-3,5-dichlorobenzene (PubChem CID 54321123) has the molecular formula C9H7BrCl2
and a molecular weight of 265.97 g/mol. Its IUPAC name is 1-(3-bromoprop-1-enyl)-3,5-dichlorobenzene.
Molecular Properties
| Compound Name | 1-(3-bromoprop-1-enyl)-3,5-dichlorobenzene |
| PubChem CID | 54321123 |
| Molecular Formula | C9H7BrCl2 |
| Molecular Weight | 265.97 g/mol |
| Exact Mass | 263.91 |
| IUPAC Name | 1-(3-bromoprop-1-enyl)-3,5-dichlorobenzene |
| SMILES | Clc1cc(Cl)cc(C=CCBr)c1 |
| InChI | InChI=1S/C9H7BrCl2/c10-3-1-2-7-4-8(11)6-9(12)5-7/h1-2,4-6H,3H2 |
| InChIKey | SRSXOZWDONOCFD-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.97 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-bromoprop-1-enyl)-3,5-dichlorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-bromoprop-1-enyl)-3,5-dichlorobenzene?
The IUPAC name of 1-(3-bromoprop-1-enyl)-3,5-dichlorobenzene (CID 54321123) is 1-(3-bromoprop-1-enyl)-3,5-dichlorobenzene.
What is the SMILES notation for 1-(3-bromoprop-1-enyl)-3,5-dichlorobenzene?
The canonical SMILES for 1-(3-bromoprop-1-enyl)-3,5-dichlorobenzene is Clc1cc(Cl)cc(C=CCBr)c1.
What is the InChIKey of 1-(3-bromoprop-1-enyl)-3,5-dichlorobenzene?
The InChIKey is SRSXOZWDONOCFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7BrCl2/c10-3-1-2-7-4-8(11)6-9(12)5-7/h1-2,4-6H,3H2.
What are the key properties of 1-(3-bromoprop-1-enyl)-3,5-dichlorobenzene?
1-(3-bromoprop-1-enyl)-3,5-dichlorobenzene has a molecular weight of 265.97 g/mol, XLogP of 4.40, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-bromoprop-1-enyl)-3,5-dichlorobenzene is sourced from PubChem (CID 54321123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).