C26H29Cl2N3O3 — CID 54321221
methyl 2-[8-(5,8-dichloro-1,2,3,4-tetrahydronaphthalen-2-yl)-4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-3-yl]acetate (PubChem CID 54321221) has the molecular formula C26H29Cl2N3O3 and a molecular weight of 502.44 g/mol. Its IUPAC name is methyl 2-[8-(5,8-dichloro-1,2,3,4-tetrahydronaphthalen-2-yl)-4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-3-yl]acetate.
| Compound Name | methyl 2-[8-(5,8-dichloro-1,2,3,4-tetrahydronaphthalen-2-yl)-4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-3-yl]acetate |
|---|---|
| PubChem CID | 54321221 |
| Molecular Formula | C26H29Cl2N3O3 |
| Molecular Weight | 502.44 g/mol |
| Exact Mass | 501.16 |
| IUPAC Name | methyl 2-[8-(5,8-dichloro-1,2,3,4-tetrahydronaphthalen-2-yl)-4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-3-yl]acetate |
| SMILES | COC(=O)CN1CN(c2ccccc2)C2(CCN(C3CCc4c(Cl)ccc(Cl)c4C3)CC2)C1=O |
| InChI | InChI=1S/C26H29Cl2N3O3/c1-34-24(32)16-30-17-31(18-5-3-2-4-6-18)26(25(30)33)11-13-29(14-12-26)19-7-8-20-21(15-19)23(28)10-9-22(20)27/h2-6,9-10,19H,7-8,11-17H2,1H3 |
| InChIKey | SRUQHVFBSOYGGK-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.44 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |