C14H23NO3 — CID 54321253
tert-butyl (3aR,4R,7aR)-4-(hydroxymethyl)-1,3,3a,4,5,7a-hexahydroisoindole-2-carboxylate (PubChem CID 54321253) has the molecular formula C14H23NO3 and a molecular weight of 253.34 g/mol. Its IUPAC name is tert-butyl (3aR,4R,7aR)-4-(hydroxymethyl)-1,3,3a,4,5,7a-hexahydroisoindole-2-carboxylate.
| Compound Name | tert-butyl (3aR,4R,7aR)-4-(hydroxymethyl)-1,3,3a,4,5,7a-hexahydroisoindole-2-carboxylate |
|---|---|
| PubChem CID | 54321253 |
| Molecular Formula | C14H23NO3 |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.17 |
| IUPAC Name | tert-butyl (3aR,4R,7aR)-4-(hydroxymethyl)-1,3,3a,4,5,7a-hexahydroisoindole-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@H]2[C@H](CO)CC=C[C@H]2C1 |
| InChI | InChI=1S/C14H23NO3/c1-14(2,3)18-13(17)15-7-10-5-4-6-11(9-16)12(10)8-15/h4-5,10-12,16H,6-9H2,1-3H3/t10-,11-,12+/m0/s1 |
| InChIKey | SRVIFWYJAOQXOV-SDDRHHMPSA-N |
| XLogP | 2.04 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|