C21H13ClF3N3O4 — CID 54321538
1-[5-(3-chloro-4-nitrobenzoyl)-6,11-dihydropyrrolo[2,1-c][1,4]benzodiazepin-9-yl]-2,2,2-trifluoroethanone (PubChem CID 54321538) has the molecular formula C21H13ClF3N3O4 and a molecular weight of 463.80 g/mol. Its IUPAC name is 1-[5-(3-chloro-4-nitrobenzoyl)-6,11-dihydropyrrolo[2,1-c][1,4]benzodiazepin-9-yl]-2,2,2-trifluoroethanone.
| Compound Name | 1-[5-(3-chloro-4-nitrobenzoyl)-6,11-dihydropyrrolo[2,1-c][1,4]benzodiazepin-9-yl]-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 54321538 |
| Molecular Formula | C21H13ClF3N3O4 |
| Molecular Weight | 463.80 g/mol |
| Exact Mass | 463.05 |
| IUPAC Name | 1-[5-(3-chloro-4-nitrobenzoyl)-6,11-dihydropyrrolo[2,1-c][1,4]benzodiazepin-9-yl]-2,2,2-trifluoroethanone |
| SMILES | O=C(c1ccc([N+](=O)[O-])c(Cl)c1)N1Cc2ccc(C(=O)C(F)(F)F)n2Cc2ccccc21 |
| InChI | InChI=1S/C21H13ClF3N3O4/c22-15-9-12(5-7-17(15)28(31)32)20(30)27-11-14-6-8-18(19(29)21(23,24)25)26(14)10-13-3-1-2-4-16(13)27/h1-9H,10-11H2 |
| InChIKey | SSAMDTYAZFFNDO-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 85.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.80 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|