About 1,3-bis(5-methyl-2-oxo-1,3-dioxan-5-yl)propane-1,3-dione
1,3-bis(5-methyl-2-oxo-1,3-dioxan-5-yl)propane-1,3-dione (PubChem CID 54321585) has the molecular formula C13H16O8
and a molecular weight of 300.26 g/mol. Its IUPAC name is 1,3-bis(5-methyl-2-oxo-1,3-dioxan-5-yl)propane-1,3-dione.
Molecular Properties
| Compound Name | 1,3-bis(5-methyl-2-oxo-1,3-dioxan-5-yl)propane-1,3-dione |
| PubChem CID | 54321585 |
| Molecular Formula | C13H16O8 |
| Molecular Weight | 300.26 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | 1,3-bis(5-methyl-2-oxo-1,3-dioxan-5-yl)propane-1,3-dione |
| SMILES | CC1(C(=O)CC(=O)C2(C)COC(=O)OC2)COC(=O)OC1 |
| InChI | InChI=1S/C13H16O8/c1-12(4-18-10(16)19-5-12)8(14)3-9(15)13(2)6-20-11(17)21-7-13/h3-7H2,1-2H3 |
| InChIKey | SSBBZOHBMWRJMT-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.26 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 1,3-bis(5-methyl-2-oxo-1,3-dioxan-5-yl)propane-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-bis(5-methyl-2-oxo-1,3-dioxan-5-yl)propane-1,3-dione?
The IUPAC name of 1,3-bis(5-methyl-2-oxo-1,3-dioxan-5-yl)propane-1,3-dione (CID 54321585) is 1,3-bis(5-methyl-2-oxo-1,3-dioxan-5-yl)propane-1,3-dione.
What is the SMILES notation for 1,3-bis(5-methyl-2-oxo-1,3-dioxan-5-yl)propane-1,3-dione?
The canonical SMILES for 1,3-bis(5-methyl-2-oxo-1,3-dioxan-5-yl)propane-1,3-dione is CC1(C(=O)CC(=O)C2(C)COC(=O)OC2)COC(=O)OC1.
What is the InChIKey of 1,3-bis(5-methyl-2-oxo-1,3-dioxan-5-yl)propane-1,3-dione?
The InChIKey is SSBBZOHBMWRJMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16O8/c1-12(4-18-10(16)19-5-12)8(14)3-9(15)13(2)6-20-11(17)21-7-13/h3-7H2,1-2H3.
What are the key properties of 1,3-bis(5-methyl-2-oxo-1,3-dioxan-5-yl)propane-1,3-dione?
1,3-bis(5-methyl-2-oxo-1,3-dioxan-5-yl)propane-1,3-dione has a molecular weight of 300.26 g/mol, XLogP of 0.86, 4 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-bis(5-methyl-2-oxo-1,3-dioxan-5-yl)propane-1,3-dione is sourced from PubChem (CID 54321585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).