About 2-fluoro-4,4-dimethoxy-3-methylbut-2-enal
2-fluoro-4,4-dimethoxy-3-methylbut-2-enal (PubChem CID 54321801) has the molecular formula C7H11FO3
and a molecular weight of 162.16 g/mol. Its IUPAC name is 2-fluoro-4,4-dimethoxy-3-methylbut-2-enal.
Molecular Properties
| Compound Name | 2-fluoro-4,4-dimethoxy-3-methylbut-2-enal |
| PubChem CID | 54321801 |
| Molecular Formula | C7H11FO3 |
| Molecular Weight | 162.16 g/mol |
| Exact Mass | 162.07 |
| IUPAC Name | 2-fluoro-4,4-dimethoxy-3-methylbut-2-enal |
| SMILES | COC(OC)C(C)=C(F)C=O |
| InChI | InChI=1S/C7H11FO3/c1-5(6(8)4-9)7(10-2)11-3/h4,7H,1-3H3 |
| InChIKey | SSEIXODJUZNTNG-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.16 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoro-4,4-dimethoxy-3-methylbut-2-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-4,4-dimethoxy-3-methylbut-2-enal?
The IUPAC name of 2-fluoro-4,4-dimethoxy-3-methylbut-2-enal (CID 54321801) is 2-fluoro-4,4-dimethoxy-3-methylbut-2-enal.
What is the SMILES notation for 2-fluoro-4,4-dimethoxy-3-methylbut-2-enal?
The canonical SMILES for 2-fluoro-4,4-dimethoxy-3-methylbut-2-enal is COC(OC)C(C)=C(F)C=O.
What is the InChIKey of 2-fluoro-4,4-dimethoxy-3-methylbut-2-enal?
The InChIKey is SSEIXODJUZNTNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11FO3/c1-5(6(8)4-9)7(10-2)11-3/h4,7H,1-3H3.
What are the key properties of 2-fluoro-4,4-dimethoxy-3-methylbut-2-enal?
2-fluoro-4,4-dimethoxy-3-methylbut-2-enal has a molecular weight of 162.16 g/mol, XLogP of 1.05, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-4,4-dimethoxy-3-methylbut-2-enal is sourced from PubChem (CID 54321801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).