About 1-(3,7-dimethylocta-2,6-dienylamino)propan-2-ol
1-(3,7-dimethylocta-2,6-dienylamino)propan-2-ol (PubChem CID 54322729) has the molecular formula C13H25NO
and a molecular weight of 211.35 g/mol. Its IUPAC name is 1-(3,7-dimethylocta-2,6-dienylamino)propan-2-ol.
Molecular Properties
| Compound Name | 1-(3,7-dimethylocta-2,6-dienylamino)propan-2-ol |
| PubChem CID | 54322729 |
| Molecular Formula | C13H25NO |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.19 |
| IUPAC Name | 1-(3,7-dimethylocta-2,6-dienylamino)propan-2-ol |
| SMILES | CC(C)=CCCC(C)=CCNCC(C)O |
| InChI | InChI=1S/C13H25NO/c1-11(2)6-5-7-12(3)8-9-14-10-13(4)15/h6,8,13-15H,5,7,9-10H2,1-4H3 |
| InChIKey | SSTSJWCQEQNREW-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-(3,7-dimethylocta-2,6-dienylamino)propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,7-dimethylocta-2,6-dienylamino)propan-2-ol?
The IUPAC name of 1-(3,7-dimethylocta-2,6-dienylamino)propan-2-ol (CID 54322729) is 1-(3,7-dimethylocta-2,6-dienylamino)propan-2-ol.
What is the SMILES notation for 1-(3,7-dimethylocta-2,6-dienylamino)propan-2-ol?
The canonical SMILES for 1-(3,7-dimethylocta-2,6-dienylamino)propan-2-ol is CC(C)=CCCC(C)=CCNCC(C)O.
What is the InChIKey of 1-(3,7-dimethylocta-2,6-dienylamino)propan-2-ol?
The InChIKey is SSTSJWCQEQNREW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25NO/c1-11(2)6-5-7-12(3)8-9-14-10-13(4)15/h6,8,13-15H,5,7,9-10H2,1-4H3.
What are the key properties of 1-(3,7-dimethylocta-2,6-dienylamino)propan-2-ol?
1-(3,7-dimethylocta-2,6-dienylamino)propan-2-ol has a molecular weight of 211.35 g/mol, XLogP of 2.65, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,7-dimethylocta-2,6-dienylamino)propan-2-ol is sourced from PubChem (CID 54322729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).