About methyl 2,3-dimethylbutanoate;methyl 2,2-dimethylpropanoate
methyl 2,3-dimethylbutanoate;methyl 2,2-dimethylpropanoate (PubChem CID 54322958) has the molecular formula C13H26O4
and a molecular weight of 246.35 g/mol. Its IUPAC name is methyl 2,3-dimethylbutanoate;methyl 2,2-dimethylpropanoate.
Analyze methyl 2,3-dimethylbutanoate;methyl 2,2-dimethylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2,3-dimethylbutanoate;methyl 2,2-dimethylpropanoate?
The IUPAC name of methyl 2,3-dimethylbutanoate;methyl 2,2-dimethylpropanoate (CID 54322958) is methyl 2,3-dimethylbutanoate;methyl 2,2-dimethylpropanoate.
What is the SMILES notation for methyl 2,3-dimethylbutanoate;methyl 2,2-dimethylpropanoate?
The canonical SMILES for methyl 2,3-dimethylbutanoate;methyl 2,2-dimethylpropanoate is COC(=O)C(C)(C)C.COC(=O)C(C)C(C)C.
What is the InChIKey of methyl 2,3-dimethylbutanoate;methyl 2,2-dimethylpropanoate?
The InChIKey is SSXOLXAIFMGDHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14O2.C6H12O2/c1-5(2)6(3)7(8)9-4;1-6(2,3)5(7)8-4/h5-6H,1-4H3;1-4H3.
What are the key properties of methyl 2,3-dimethylbutanoate;methyl 2,2-dimethylpropanoate?
methyl 2,3-dimethylbutanoate;methyl 2,2-dimethylpropanoate has a molecular weight of 246.35 g/mol, XLogP of 2.66, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2,3-dimethylbutanoate;methyl 2,2-dimethylpropanoate is sourced from PubChem (CID 54322958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).